CAS 471856-97-0 is the registry number for 4-[1-(Trifluoromethyl)vinyl]benzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,3,3-trifluoroprop-1-en-2-yl)benzonitrile (CAS 471856-97-0) is a chemical compound with the molecular formula C10H6F3N and a molecular weight of 197.16 g/mol. IUPAC name: 4-(3,3,3-trifluoroprop-1-en-2-yl)benzonitrile. InChIKey: YMCLDFVIIXBKHP-UHFFFAOYSA-N.
| Molecular formula | C10H6F3N |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 4-(3,3,3-trifluoroprop-1-en-2-yl)benzonitrile |
| InChIKey | YMCLDFVIIXBKHP-UHFFFAOYSA-N |
| SMILES | C=C(C1=CC=C(C=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)