CAS 4734-23-0 is the registry number for 4-Chloro-5-(1-pyrrolidinyl)-3(2H)-pyridazinone. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-chloro-4-pyrrolidin-1-yl-1H-pyridazin-6-one (CAS 4734-23-0) is a chemical compound with the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. IUPAC name: 5-chloro-4-pyrrolidin-1-yl-1H-pyridazin-6-one. InChIKey: CMQXAJVJQMYVQC-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3O |
|---|---|
| Molecular weight | 199.64 g/mol |
| IUPAC name | 5-chloro-4-pyrrolidin-1-yl-1H-pyridazin-6-one |
| InChIKey | CMQXAJVJQMYVQC-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=C(C(=O)NN=C2)Cl |
Computed by PubChem (NCBI)