CAS 473994-26-2 is the registry number for 5-(Adamantan-1-yl)-4H-1,2,4-triazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
5-(1-adamantyl)-1H-1,2,4-triazol-3-amine (CAS 473994-26-2) is a chemical compound with the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. IUPAC name: 5-(1-adamantyl)-1H-1,2,4-triazol-3-amine. InChIKey: YAOKRNZRTCOYSW-UHFFFAOYSA-N.
| Molecular formula | C12H18N4 |
|---|---|
| Molecular weight | 218.30 g/mol |
| IUPAC name | 5-(1-adamantyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | YAOKRNZRTCOYSW-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=NC(=NN4)N |
Computed by PubChem (NCBI)