CAS 915920-86-4 is the registry number for 3-(1H-1,2,4-Triazol-1-yl)-1-adamantanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
3-(1,2,4-triazol-1-yl)adamantan-1-amine (CAS 915920-86-4) is a chemical compound with the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. IUPAC name: 3-(1,2,4-triazol-1-yl)adamantan-1-amine. InChIKey: MEBRHDOGOQBNLX-UHFFFAOYSA-N.
| Molecular formula | C12H18N4 |
|---|---|
| Molecular weight | 218.30 g/mol |
| IUPAC name | 3-(1,2,4-triazol-1-yl)adamantan-1-amine |
| InChIKey | MEBRHDOGOQBNLX-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)N4C=NC=N4)N |
Computed by PubChem (NCBI)