Products 474004-02-9

CAS 474004-02-9 is the registry number for N-4-Quinazolinylvaline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-methyl-2-(quinazolin-4-ylamino)butanoic acid (CAS 474004-02-9) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: 3-methyl-2-(quinazolin-4-ylamino)butanoic acid. InChIKey: LHNBRZQJEHYCGL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15N3O2
Molecular weight245.28 g/mol
IUPAC name3-methyl-2-(quinazolin-4-ylamino)butanoic acid
InChIKeyLHNBRZQJEHYCGL-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)O)NC1=NC=NC2=CC=CC=C21

Computed by PubChem (NCBI)