CAS 4746-75-2 is the registry number for 2,2'-Dimethoxy-[1,1'-biphenyl]-4,4'-diamine, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-(4-amino-2-methoxyphenyl)-3-methoxyaniline (CAS 4746-75-2) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: 4-(4-amino-2-methoxyphenyl)-3-methoxyaniline. InChIKey: YJOAIOIVLVUPST-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 4-(4-amino-2-methoxyphenyl)-3-methoxyaniline |
| InChIKey | YJOAIOIVLVUPST-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)C2=C(C=C(C=C2)N)OC |
Computed by PubChem (NCBI)