CAS 4747-46-0 appears in our catalog under these names: 1-Phenyl-1h-pyrazole-3-carboxylic acid, 95%, 1–Phenyl–1H–pyrazole–3–carboxylic acid, 1-Phenyl-1H-pyrazole-3-carboxylic acid, 1-Phenyl-1H-pyrazole-3-carboxylic acid, 97%, 97%, 1-Phenyl-1H-pyrazole-3-carboxylic acid, 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 0,5g, 500mg.
1-phenylpyrazole-3-carboxylic acid (CAS 4747-46-0) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 1-phenylpyrazole-3-carboxylic acid. InChIKey: LAWUBNJMRGMNQD-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 1-phenylpyrazole-3-carboxylic acid |
| InChIKey | LAWUBNJMRGMNQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)