Products 474708-09-3

CAS 474708-09-3 is the registry number for Olmesartan Medoxomil Impurity 103. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate (CAS 474708-09-3) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: methyl 3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate. InChIKey: KOFNWCCYWMSYSU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O4
Molecular weight266.29 g/mol
IUPAC namemethyl 3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoate
InChIKeyKOFNWCCYWMSYSU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C=CC=C1N)C(=O)OC

Computed by PubChem (NCBI)