Products 4749-70-6

CAS 4749-70-6 is the registry number for ethyl methyl fumarate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-O-ethyl 1-O-methyl (E)-but-2-enedioate (CAS 4749-70-6) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: 4-O-ethyl 1-O-methyl (E)-but-2-enedioate. InChIKey: JDOZUYVDIAKODH-SNAWJCMRSA-N.

Identity
Molecular formulaC7H10O4
Molecular weight158.15 g/mol
IUPAC name4-O-ethyl 1-O-methyl (E)-but-2-enedioate
InChIKeyJDOZUYVDIAKODH-SNAWJCMRSA-N
SMILESCCOC(=O)/C=C/C(=O)OC

Computed by PubChem (NCBI)