CAS 474909-54-1 is the registry number for 3-Methoxy-4-Hydroxyphenylglycol sulfate-d3 (potassium), 99.1%. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
Potassium [4-(1,2-dihydroxyethyl)-2-(trideuteriomethoxy)phenyl] sulfate (CAS 474909-54-1) is a chemical compound with the molecular formula C9H11KO7S and a molecular weight of 305.36 g/mol. IUPAC name: potassium [4-(1,2-dihydroxyethyl)-2-(trideuteriomethoxy)phenyl] sulfate. InChIKey: XFZJWBFZLNLKNR-NIIDSAIPSA-M.
| Molecular formula | C9H11KO7S |
|---|---|
| Molecular weight | 305.36 g/mol |
| IUPAC name | potassium [4-(1,2-dihydroxyethyl)-2-(trideuteriomethoxy)phenyl] sulfate |
| InChIKey | XFZJWBFZLNLKNR-NIIDSAIPSA-M |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)C(CO)O)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)