Products 475086-96-5

CAS 475086-96-5 is the registry number for Selexipag Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2-[4-(5,6-diphenylpyrazin-2-yl)oxybutoxy]acetate (CAS 475086-96-5) is a chemical compound with the molecular formula C26H30N2O4 and a molecular weight of 434.5 g/mol. IUPAC name: tert-butyl 2-[4-(5,6-diphenylpyrazin-2-yl)oxybutoxy]acetate. InChIKey: ZGPRZQWEXLXPSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC26H30N2O4
Molecular weight434.5 g/mol
IUPAC nametert-butyl 2-[4-(5,6-diphenylpyrazin-2-yl)oxybutoxy]acetate
InChIKeyZGPRZQWEXLXPSZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)COCCCCOC1=CN=C(C(=N1)C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)