Products 408497-91-6
CAS 408497-91-6 appears in our catalog under these names: Formoterol Impurity 22, Formoterol Impurity 21. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-2-phenylmethoxyphenyl]formamide (CAS 408497-91-6) is a chemical compound with the molecular formula C26H30N2O4 and a molecular weight of 434.5 g/mol. IUPAC name: N-[5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-2-phenylmethoxyphenyl]formamide. InChIKey: RIYABDFRTCZRRF-CLOONOSVSA-N.
| Molecular formula | C26H30N2O4 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | N-[5-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]-2-phenylmethoxyphenyl]formamide |
| InChIKey | RIYABDFRTCZRRF-CLOONOSVSA-N |
| SMILES | C[C@H](CC1=CC=C(C=C1)OC)NC[C@@H](C2=CC(=C(C=C2)OCC3=CC=CC=C3)NC=O)O |
Computed by PubChem (NCBI)