Products 67346-67-2
CAS 67346-67-2 appears in our catalog under these names: (S,S)- Formoterol 2-Benzyl, Formoterol Impurity 28. Offered by: TRC, Biosynth, Chemat Brand. Available pack sizes: 100mg, 50mg, 25mg, on request.
N-[5-[(1S)-2-[benzyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide (CAS 67346-67-2) is a chemical compound with the molecular formula C26H30N2O4 and a molecular weight of 434.5 g/mol. IUPAC name: N-[5-[(1S)-2-[benzyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide. InChIKey: AIPPHYOPXCWGQJ-AFMDSPMNSA-N.
| Molecular formula | C26H30N2O4 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | N-[5-[(1S)-2-[benzyl-[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]-1-hydroxyethyl]-2-hydroxyphenyl]formamide |
| InChIKey | AIPPHYOPXCWGQJ-AFMDSPMNSA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)OC)N(CC2=CC=CC=C2)C[C@H](C3=CC(=C(C=C3)O)NC=O)O |
Computed by PubChem (NCBI)