CAS 477251-78-8 is the registry number for 1-(3-Bromo-phenyl)-4-oxo-1,4-dihydro-[1,8]naphthyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3-bromophenyl)-4-oxo-1,8-naphthyridine-3-carboxylic acid (CAS 477251-78-8) is a chemical compound with the molecular formula C15H9BrN2O3 and a molecular weight of 345.15 g/mol. IUPAC name: 1-(3-bromophenyl)-4-oxo-1,8-naphthyridine-3-carboxylic acid. InChIKey: KBPQWHYPWLDFRS-UHFFFAOYSA-N.
| Molecular formula | C15H9BrN2O3 |
|---|---|
| Molecular weight | 345.15 g/mol |
| IUPAC name | 1-(3-bromophenyl)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| InChIKey | KBPQWHYPWLDFRS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)N2C=C(C(=O)C3=C2N=CC=C3)C(=O)O |
Computed by PubChem (NCBI)