CAS 53460-53-0 is the registry number for 5-Bromo-2,3-dioxo-N-phenylindoline-1-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2,3-dioxo-N-phenylindole-1-carboxamide (CAS 53460-53-0) is a chemical compound with the molecular formula C15H9BrN2O3 and a molecular weight of 345.15 g/mol. IUPAC name: 5-bromo-2,3-dioxo-N-phenylindole-1-carboxamide. InChIKey: FICRSOFBRCDGQH-UHFFFAOYSA-N.
| Molecular formula | C15H9BrN2O3 |
|---|---|
| Molecular weight | 345.15 g/mol |
| IUPAC name | 5-bromo-2,3-dioxo-N-phenylindole-1-carboxamide |
| InChIKey | FICRSOFBRCDGQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)N2C3=C(C=C(C=C3)Br)C(=O)C2=O |
Computed by PubChem (NCBI)