CAS 477712-00-8 is the registry number for 5-(4-Chlorophenyl)-1-(2,5-dichlorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.
5-(4-chlorophenyl)-1-(2,5-dichlorophenyl)pyrazole-3-carboxylic acid (CAS 477712-00-8) is a chemical compound with the molecular formula C16H9Cl3N2O2 and a molecular weight of 367.6 g/mol. IUPAC name: 5-(4-chlorophenyl)-1-(2,5-dichlorophenyl)pyrazole-3-carboxylic acid. InChIKey: NAUUAZLLMJXFJZ-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl3N2O2 |
|---|---|
| Molecular weight | 367.6 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1-(2,5-dichlorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | NAUUAZLLMJXFJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NN2C3=C(C=CC(=C3)Cl)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)