CAS 477712-31-5 is the registry number for 1-(3-Chlorophenyl)-5-(3,4-dichlorophenyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.
1-(3-chlorophenyl)-5-(3,4-dichlorophenyl)pyrazole-3-carboxylic acid (CAS 477712-31-5) is a chemical compound with the molecular formula C16H9Cl3N2O2 and a molecular weight of 367.6 g/mol. IUPAC name: 1-(3-chlorophenyl)-5-(3,4-dichlorophenyl)pyrazole-3-carboxylic acid. InChIKey: FLKAZVJYCZPURB-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl3N2O2 |
|---|---|
| Molecular weight | 367.6 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-5-(3,4-dichlorophenyl)pyrazole-3-carboxylic acid |
| InChIKey | FLKAZVJYCZPURB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)N2C(=CC(=N2)C(=O)O)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)