Products 477712-30-4

CAS 477712-30-4 is the registry number for 5-(3,4-Dichlorophenyl)-1-phenyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.

Structural formula: {0} (CAS {1})

5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylic acid (CAS 477712-30-4) is a chemical compound with the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.2 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylic acid. InChIKey: CGAOXSZEALULKE-UHFFFAOYSA-N.

Identity
Molecular formulaC16H10Cl2N2O2
Molecular weight333.2 g/mol
IUPAC name5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylic acid
InChIKeyCGAOXSZEALULKE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=CC(=N2)C(=O)O)C3=CC(=C(C=C3)Cl)Cl

Computed by PubChem (NCBI)