CAS 477712-30-4 is the registry number for 5-(3,4-Dichlorophenyl)-1-phenyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylic acid (CAS 477712-30-4) is a chemical compound with the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.2 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylic acid. InChIKey: CGAOXSZEALULKE-UHFFFAOYSA-N.
| Molecular formula | C16H10Cl2N2O2 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylic acid |
| InChIKey | CGAOXSZEALULKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=CC(=N2)C(=O)O)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)