Products 477712-39-3

CAS 477712-39-3 is the registry number for 1-(2,4-Dichlorophenyl)-5-phenyl-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 500mg.

Structural formula: {0} (CAS {1})

1-(2,4-dichlorophenyl)-5-phenylpyrazole-3-carboxylic acid (CAS 477712-39-3) is a chemical compound with the molecular formula C16H10Cl2N2O2 and a molecular weight of 333.2 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-5-phenylpyrazole-3-carboxylic acid. InChIKey: AJFKCJRMHHBFNS-UHFFFAOYSA-N.

Identity
Molecular formulaC16H10Cl2N2O2
Molecular weight333.2 g/mol
IUPAC name1-(2,4-dichlorophenyl)-5-phenylpyrazole-3-carboxylic acid
InChIKeyAJFKCJRMHHBFNS-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=NN2C3=C(C=C(C=C3)Cl)Cl)C(=O)O

Computed by PubChem (NCBI)