CAS 477760-86-4 appears in our catalog under these names: (4'–Hydroxy–(1,1'–biphenyl)–4–yl)boronic acid, (4'-Hydroxy-[1,1'-biphenyl]-4-yl)boronic acid 98%, (4'-Hydroxy-[1,1'-biphenyl]-4-yl)boronic acid, 98%, (4'-Hydroxy-[1,1'-biphenyl]-4-yl)boronic acid, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg.
[4-(4-hydroxyphenyl)phenyl]boronic acid (CAS 477760-86-4) is a chemical compound with the molecular formula C12H11BO3 and a molecular weight of 214.03 g/mol. IUPAC name: [4-(4-hydroxyphenyl)phenyl]boronic acid. InChIKey: DGIKALCQCSMOTG-UHFFFAOYSA-N.
| Molecular formula | C12H11BO3 |
|---|---|
| Molecular weight | 214.03 g/mol |
| IUPAC name | [4-(4-hydroxyphenyl)phenyl]boronic acid |
| InChIKey | DGIKALCQCSMOTG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)O)(O)O |
Computed by PubChem (NCBI)