Products 51067-38-0
CAS 51067-38-0 appears in our catalog under these names: 4-Phenoxybenzeneboronic acid, 98% , 4-Phenoxyphenylboronic acid, 4-Phenoxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Phenoxyphenylboronic acid, 95+%, 4-Phenoxyphenylboronic acid 98%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 1g, 5g, 250g, 25g, 10g, 100g, 500g, 1000g.
(4-phenoxyphenyl)boronic acid (CAS 51067-38-0) is a chemical compound with the molecular formula C12H11BO3 and a molecular weight of 214.03 g/mol. IUPAC name: (4-phenoxyphenyl)boronic acid. InChIKey: KFXUHRXGLWUOJT-UHFFFAOYSA-N.
| Molecular formula | C12H11BO3 |
|---|---|
| Molecular weight | 214.03 g/mol |
| IUPAC name | (4-phenoxyphenyl)boronic acid |
| InChIKey | KFXUHRXGLWUOJT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Phenoxyphenylboronic acid, 4-Phenoxybenzeneboronic acid, (4-phenoxyphenyl)boronic acid, (4-Phenoxyphenyl)boronic acid;4-Phenoxyphenylboronic acid, 4-phenoxyphenylboronic acid (contains varying amounts of anhydride), Boronic acid, (4-phenoxyphenyl)-, 4-phenoxyphenyl boronic acid, 4-phenyoxyphenylboronic acid, 4-phenoxy-phenylboronic acid, 4-Phenoxyphenyl-boronic acid