CAS 478010-86-5 is the registry number for 3-Chloro-5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol (CAS 478010-86-5) is a chemical compound with the molecular formula C14H19ClO and a molecular weight of 238.75 g/mol. IUPAC name: 3-chloro-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol. InChIKey: YUESNYSOWGZFHM-UHFFFAOYSA-N.
| Molecular formula | C14H19ClO |
|---|---|
| Molecular weight | 238.75 g/mol |
| IUPAC name | 3-chloro-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-ol |
| InChIKey | YUESNYSOWGZFHM-UHFFFAOYSA-N |
| SMILES | CC1(CCC(C2=CC(=C(C=C21)O)Cl)(C)C)C |
Computed by PubChem (NCBI)