Products 50606-96-7

CAS 50606-96-7 appears in our catalog under these names: 4-N-Heptylbenzoyl chloride, 98%, 4-Heptylbenzoyl Chloride, >98.0%(T), 4-HEPTYLBENZOYL CHLORIDE, 99%, 4-Heptylbenzoyl chloride. Offered by: Combi-blocks, TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

4-heptylbenzoyl chloride (CAS 50606-96-7) is a chemical compound with the molecular formula C14H19ClO and a molecular weight of 238.75 g/mol. IUPAC name: 4-heptylbenzoyl chloride. InChIKey: WHTFLTOKFXTJGV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19ClO
Molecular weight238.75 g/mol
IUPAC name4-heptylbenzoyl chloride
InChIKeyWHTFLTOKFXTJGV-UHFFFAOYSA-N
SMILESCCCCCCCC1=CC=C(C=C1)C(=O)Cl

Computed by PubChem (NCBI)