Products 478313-96-1
CAS 478313-96-1 is the registry number for (4Z,6E)-5-Hydroxy-1,7-diphenylhepta-4,6-dien-3-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4Z,6E)-5-hydroxy-1,7-diphenylhepta-4,6-dien-3-one (CAS 478313-96-1) is a chemical compound with the molecular formula C19H18O2 and a molecular weight of 278.3 g/mol. IUPAC name: (4Z,6E)-5-hydroxy-1,7-diphenylhepta-4,6-dien-3-one. InChIKey: MJCANANSGRMBIC-HHEXEYPASA-N.
| Molecular formula | C19H18O2 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | (4Z,6E)-5-hydroxy-1,7-diphenylhepta-4,6-dien-3-one |
| InChIKey | MJCANANSGRMBIC-HHEXEYPASA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)/C=C(/C=C/C2=CC=CC=C2)\O |
Computed by PubChem (NCBI)