CAS 852171-80-3 is the registry number for 4-(4-tert-Butylphenyl)-2H-chromen-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
4-(4-tert-butylphenyl)chromen-2-one (CAS 852171-80-3) is a chemical compound with the molecular formula C19H18O2 and a molecular weight of 278.3 g/mol. IUPAC name: 4-(4-tert-butylphenyl)chromen-2-one. InChIKey: VWCJZNUNSUVWMR-UHFFFAOYSA-N.
| Molecular formula | C19H18O2 |
|---|---|
| Molecular weight | 278.3 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)chromen-2-one |
| InChIKey | VWCJZNUNSUVWMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC(=O)OC3=CC=CC=C32 |
Computed by PubChem (NCBI)