Products 478511-54-5
CAS 478511-54-5 is the registry number for Rhamnose-13C-2 (monohydrate), 99.0%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy(313C)hexanal;hydrate (CAS 478511-54-5) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 183.16 g/mol. IUPAC name: (2R,3R,4S,5S)-2,3,4,5-tetrahydroxy(313C)hexanal;hydrate. InChIKey: CBDCDOTZPYZPRO-SKWSBVGESA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | (2R,3R,4S,5S)-2,3,4,5-tetrahydroxy(313C)hexanal;hydrate |
| InChIKey | CBDCDOTZPYZPRO-SKWSBVGESA-N |
| SMILES | C[C@@H]([C@@H]([13C@H]([C@H](C=O)O)O)O)O.O |
Computed by PubChem (NCBI)