CAS 478518-49-9 appears in our catalog under these names: D-Fructose-4,5,6,6-d4, D–Fructose–d4, D-Fructose-d4, 99.9%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 1mg, 10mg, 5mg, 50mg, 100mg, 10 mg.
(3S,4R,5R)-4,5,6,6-tetradeuterio-2-(hydroxymethyl)oxane-2,3,4,5-tetrol (CAS 478518-49-9) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 184.18 g/mol. IUPAC name: (3S,4R,5R)-4,5,6,6-tetradeuterio-2-(hydroxymethyl)oxane-2,3,4,5-tetrol. InChIKey: LKDRXBCSQODPBY-VOTBCCCISA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | (3S,4R,5R)-4,5,6,6-tetradeuterio-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| InChIKey | LKDRXBCSQODPBY-VOTBCCCISA-N |
| SMILES | [2H][C@@]1([C@@H](C(OC([C@@]1([2H])O)([2H])[2H])(CO)O)O)O |
Computed by PubChem (NCBI)