Products 478518-50-2
CAS 478518-50-2 is the registry number for (-)-Fucose-13C-2. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(3S,4R,5S,6S)-6-methyl(413C)oxane-2,3,4,5-tetrol (CAS 478518-50-2) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 165.15 g/mol. IUPAC name: (3S,4R,5S,6S)-6-methyl(413C)oxane-2,3,4,5-tetrol. InChIKey: SHZGCJCMOBCMKK-IZKXOTGOSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | (3S,4R,5S,6S)-6-methyl(413C)oxane-2,3,4,5-tetrol |
| InChIKey | SHZGCJCMOBCMKK-IZKXOTGOSA-N |
| SMILES | C[C@H]1[C@H]([13C@H]([C@@H](C(O1)O)O)O)O |
Computed by PubChem (NCBI)