Products 478529-58-7
CAS 478529-58-7 is the registry number for (R)-2,3-Dihydroxypropanal-d2. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2R)-3,3-dideuterio-2,3-dihydroxypropanal (CAS 478529-58-7) is a chemical compound with the molecular formula C3H6O3 and a molecular weight of 92.09 g/mol. IUPAC name: (2R)-3,3-dideuterio-2,3-dihydroxypropanal. InChIKey: MNQZXJOMYWMBOU-NFTRXVFISA-N.
| Molecular formula | C3H6O3 |
|---|---|
| Molecular weight | 92.09 g/mol |
| IUPAC name | (2R)-3,3-dideuterio-2,3-dihydroxypropanal |
| InChIKey | MNQZXJOMYWMBOU-NFTRXVFISA-N |
| SMILES | [2H]C([2H])([C@H](C=O)O)O |
Computed by PubChem (NCBI)