Products 478529-60-1
CAS 478529-60-1 is the registry number for (R)-2,3-Dihydroxypropanal-d4. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(2R)-1,2,3,3-tetradeuterio-2,3-dihydroxypropan-1-one (CAS 478529-60-1) is a chemical compound with the molecular formula C3H6O3 and a molecular weight of 94.10 g/mol. IUPAC name: (2R)-1,2,3,3-tetradeuterio-2,3-dihydroxypropan-1-one. InChIKey: MNQZXJOMYWMBOU-ITGMSCEKSA-N.
| Molecular formula | C3H6O3 |
|---|---|
| Molecular weight | 94.10 g/mol |
| IUPAC name | (2R)-1,2,3,3-tetradeuterio-2,3-dihydroxypropan-1-one |
| InChIKey | MNQZXJOMYWMBOU-ITGMSCEKSA-N |
| SMILES | [2H]C(=O)[C@@]([2H])(C([2H])([2H])O)O |
Computed by PubChem (NCBI)