Products 478954-81-3
CAS 478954-81-3 appears in our catalog under these names: Monobutyl Phthalate-d4, mono-n-Butyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Monobutyl phthalate–d4, Monobutyl phthalate-d4, 99.33%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,1g, 0,05g, 10mg, 5 mg, 10 mg.
2-butoxycarbonyl-3,4,5,6-tetradeuteriobenzoic acid (CAS 478954-81-3) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 226.26 g/mol. IUPAC name: 2-butoxycarbonyl-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: YZBOVSFWWNVKRJ-UGWFXTGHSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 226.26 g/mol |
| IUPAC name | 2-butoxycarbonyl-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | YZBOVSFWWNVKRJ-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCCCC)[2H])[2H] |
Computed by PubChem (NCBI)