CAS 479080-07-4 is the registry number for 3-Oxo-3-(1-pyrrolidinyl)propionamidoxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-hydroxy-3-oxo-3-pyrrolidin-1-ylpropanimidamide (CAS 479080-07-4) is a chemical compound with the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. IUPAC name: N'-hydroxy-3-oxo-3-pyrrolidin-1-ylpropanimidamide. InChIKey: ISUFAXRPGSQHIC-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O2 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | N'-hydroxy-3-oxo-3-pyrrolidin-1-ylpropanimidamide |
| InChIKey | ISUFAXRPGSQHIC-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)C/C(=N/O)/N |
Computed by PubChem (NCBI)