CAS 52208-82-9 is the registry number for Vildagliptin Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-(2-aminoacetyl)pyrrolidine-2-carboxamide (CAS 52208-82-9) is a chemical compound with the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. IUPAC name: (2S)-1-(2-aminoacetyl)pyrrolidine-2-carboxamide. InChIKey: LENAFVMQJFJAGN-YFKPBYRVSA-N.
| Molecular formula | C7H13N3O2 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | (2S)-1-(2-aminoacetyl)pyrrolidine-2-carboxamide |
| InChIKey | LENAFVMQJFJAGN-YFKPBYRVSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CN)C(=O)N |
Computed by PubChem (NCBI)