Products 915302-94-2

CAS 915302-94-2 is the registry number for 5-Oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3(R,S)-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylic acid (CAS 915302-94-2) is a chemical compound with the molecular formula C13H15NO3 and a molecular weight of 233.26 g/mol. IUPAC name: 5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylic acid. InChIKey: CFGKWSDAMXTRHE-BFHBGLAWSA-N.

Identity
Molecular formulaC13H15NO3
Molecular weight233.26 g/mol
IUPAC name5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylic acid
InChIKeyCFGKWSDAMXTRHE-BFHBGLAWSA-N
SMILESC[C@H](C1=CC=CC=C1)N2CC(CC2=O)C(=O)O

Computed by PubChem (NCBI)