CAS 4816-81-3 appears in our catalog under these names: 2-[[(4-Methylphenyl)sulfonyl]amino]propanoic acid, 95%, Tos-DL-Ala-OH 95%, 2-[[(4-Methylphenyl)sulfonyl]amino]propanoic acid, 95%, 95%, 2-(4-Methylbenzenesulfonamido)propanoic acid, 95+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-[(4-methylphenyl)sulfonylamino]propanoic acid (CAS 4816-81-3) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: 2-[(4-methylphenyl)sulfonylamino]propanoic acid. InChIKey: LQXKHFZRJYXXFA-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | 2-[(4-methylphenyl)sulfonylamino]propanoic acid |
| InChIKey | LQXKHFZRJYXXFA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(C)C(=O)O |
Computed by PubChem (NCBI)