CAS 4837-22-3 appears in our catalog under these names: 4-(Difluoro-methanesulfonyl)-benzoic acid, 98%, 4–(Difluoro–methanesulfonyl)–benzoic acid, 4-((Difluoromethyl)sulfonyl)benzoic acid, 95%, 95%, 4-(Difluoromethylsulfonyl)benzoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
4-(difluoromethylsulfonyl)benzoic acid (CAS 4837-22-3) is a chemical compound with the molecular formula C8H6F2O4S and a molecular weight of 236.19 g/mol. IUPAC name: 4-(difluoromethylsulfonyl)benzoic acid. InChIKey: BFPZRESURWVHTN-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O4S |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | 4-(difluoromethylsulfonyl)benzoic acid |
| InChIKey | BFPZRESURWVHTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)C(F)F |
Computed by PubChem (NCBI)