Products 845617-17-6

CAS 845617-17-6 is the registry number for 2,6-Difluoro-3-methanesulfonylbenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,6-difluoro-3-methylsulfonylbenzoic acid (CAS 845617-17-6) is a chemical compound with the molecular formula C8H6F2O4S and a molecular weight of 236.19 g/mol. IUPAC name: 2,6-difluoro-3-methylsulfonylbenzoic acid. InChIKey: IZGWQDLOGJHGFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O4S
Molecular weight236.19 g/mol
IUPAC name2,6-difluoro-3-methylsulfonylbenzoic acid
InChIKeyIZGWQDLOGJHGFQ-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=C(C(=C(C=C1)F)C(=O)O)F

Computed by PubChem (NCBI)