Products 4839-11-6
CAS 4839-11-6 is the registry number for Atropine Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,3S,5R,6S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol (CAS 4839-11-6) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (1S,3S,5R,6S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol. InChIKey: QWVUOVZJBNQSNS-HSNKUXOKSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | (1S,3S,5R,6S)-8-methyl-8-azabicyclo[3.2.1]octane-3,6-diol |
| InChIKey | QWVUOVZJBNQSNS-HSNKUXOKSA-N |
| SMILES | CN1[C@H]2C[C@@H](C[C@@H]1[C@H](C2)O)O |
Computed by PubChem (NCBI)