CAS 486-89-5 appears in our catalog under these names: Anagyrine, Anagyrine HBr, Anagyrine, 97%, 97%, Anagyrine, 98.15%. Offered by: GLPBio, Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, on request, 25mg, 1mg, 2mg, 10mg, 1 mg, 5 mg.
(1R,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4-dien-6-one (CAS 486-89-5) is a chemical compound with the molecular formula C15H20N2O and a molecular weight of 244.33 g/mol. IUPAC name: (1R,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4-dien-6-one. InChIKey: FQEQMASDZFXSJI-JHJVBQTASA-N.
| Molecular formula | C15H20N2O |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | (1R,9R,10R)-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4-dien-6-one |
| InChIKey | FQEQMASDZFXSJI-JHJVBQTASA-N |
| SMILES | C1CCN2C[C@H]3C[C@@H]([C@H]2C1)CN4C3=CC=CC4=O |
Computed by PubChem (NCBI)