CAS 4860-78-0 is the registry number for 6-O-Acetyl-1,2:3,4-di-O-isopropylidene-α-D-galactopyranose. Offered by: Biosynth. Available pack sizes: 5g, 1g, 10g.
(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl acetate (CAS 4860-78-0) is a chemical compound with the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. IUPAC name: (4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl acetate. InChIKey: PHWOTSJWWWEKMS-UHFFFAOYSA-N.
| Molecular formula | C14H22O7 |
|---|---|
| Molecular weight | 302.32 g/mol |
| IUPAC name | (4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)methyl acetate |
| InChIKey | PHWOTSJWWWEKMS-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1C2C(C3C(O1)OC(O3)(C)C)OC(O2)(C)C |
Computed by PubChem (NCBI)