CAS 487029-68-5 is the registry number for 2–Thiazolidinethione, 4–(1–methylethyl)–3–(1–oxopropyl)–, (4R)–. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]propan-1-one (CAS 487029-68-5) is a chemical compound with the molecular formula C9H15NOS2 and a molecular weight of 217.4 g/mol. IUPAC name: 1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]propan-1-one. InChIKey: LUMSKZAOAHMEGE-ZETCQYMHSA-N.
| Molecular formula | C9H15NOS2 |
|---|---|
| Molecular weight | 217.4 g/mol |
| IUPAC name | 1-[(4R)-4-propan-2-yl-2-sulfanylidene-1,3-thiazolidin-3-yl]propan-1-one |
| InChIKey | LUMSKZAOAHMEGE-ZETCQYMHSA-N |
| SMILES | CCC(=O)N1[C@@H](CSC1=S)C(C)C |
Computed by PubChem (NCBI)