CAS 908266-45-5 is the registry number for Tropine-3-xanthate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanylmethanethioic S-acid (CAS 908266-45-5) is a chemical compound with the molecular formula C9H15NOS2 and a molecular weight of 217.4 g/mol. IUPAC name: [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanylmethanethioic S-acid. InChIKey: JHJDYZOSHFQHMT-DHBOJHSNSA-N.
| Molecular formula | C9H15NOS2 |
|---|---|
| Molecular weight | 217.4 g/mol |
| IUPAC name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]sulfanylmethanethioic S-acid |
| InChIKey | JHJDYZOSHFQHMT-DHBOJHSNSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)SC(=O)S |
Computed by PubChem (NCBI)