CAS 4878-36-8 appears in our catalog under these names: 3,5-Diamino-6-chloropyrazine-2-carboxylic acid, 96%, Hydrochlorothiazide Impurity 3, 3,5-Diamino-6-chloropyrazine-2-carboxylic Acid, >95% (HPLC), 3,5-Diamino-6-chloropyrazine-2-carboxylic Acid, 3,5-Diamino-6-chloropyrazine-2-carboxylic acid 98%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Ambeed. Available pack sizes: 5g, 250mg, 1g, on request, 10mg, 25mg, 50mg, 100mg.
3,5-diamino-6-chloropyrazine-2-carboxylic acid (CAS 4878-36-8) is a chemical compound with the molecular formula C5H5ClN4O2 and a molecular weight of 188.57 g/mol. IUPAC name: 3,5-diamino-6-chloropyrazine-2-carboxylic acid. InChIKey: OCSQJDAUOOHJEI-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN4O2 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 3,5-diamino-6-chloropyrazine-2-carboxylic acid |
| InChIKey | OCSQJDAUOOHJEI-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(C(=N1)Cl)N)N)C(=O)O |
Computed by PubChem (NCBI)