Products 77813-57-1
CAS 77813-57-1 appears in our catalog under these names: 6-Chloro-3-hydrazinyl-4-pyridazinecarboxylic acid, 95%, 6-Chloro-3-hydrazinylpyridazine-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-chloro-3-hydrazinylpyridazine-4-carboxylic acid (CAS 77813-57-1) is a chemical compound with the molecular formula C5H5ClN4O2 and a molecular weight of 188.57 g/mol. IUPAC name: 6-chloro-3-hydrazinylpyridazine-4-carboxylic acid. InChIKey: XYSNHNLTNNUZLI-UHFFFAOYSA-N.
| Molecular formula | C5H5ClN4O2 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 6-chloro-3-hydrazinylpyridazine-4-carboxylic acid |
| InChIKey | XYSNHNLTNNUZLI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1Cl)NN)C(=O)O |
Computed by PubChem (NCBI)