CAS 488829-66-9 is the registry number for 7-Chloro-1,5-dihydro-5-(2-methylphenyl)-4,1-benzothiazepin-2(3H)-one. Offered by: TRC. Available pack sizes: 1g.
7-chloro-5-(2-methylphenyl)-1,5-dihydro-4,1-benzothiazepin-2-one (CAS 488829-66-9) is a chemical compound with the molecular formula C16H14ClNOS and a molecular weight of 303.8 g/mol. IUPAC name: 7-chloro-5-(2-methylphenyl)-1,5-dihydro-4,1-benzothiazepin-2-one. InChIKey: PKPCOZWXZOXEEF-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNOS |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 7-chloro-5-(2-methylphenyl)-1,5-dihydro-4,1-benzothiazepin-2-one |
| InChIKey | PKPCOZWXZOXEEF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2C3=C(C=CC(=C3)Cl)NC(=O)CS2 |
Computed by PubChem (NCBI)