CAS 854357-29-2 is the registry number for 2-Chloro-1-(3-phenyl-3,4-dihydro-2H-1,4-benzothiazin-4-yl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-1-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethanone (CAS 854357-29-2) is a chemical compound with the molecular formula C16H14ClNOS and a molecular weight of 303.8 g/mol. IUPAC name: 2-chloro-1-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethanone. InChIKey: OROHWSNJKUHQRF-UHFFFAOYSA-N.
| Molecular formula | C16H14ClNOS |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 2-chloro-1-(3-phenyl-2,3-dihydro-1,4-benzothiazin-4-yl)ethanone |
| InChIKey | OROHWSNJKUHQRF-UHFFFAOYSA-N |
| SMILES | C1C(N(C2=CC=CC=C2S1)C(=O)CCl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)