CAS 4891-69-4 appears in our catalog under these names: 6-Phenyl-4-pyrimidinol, 95%, 6-Phenylpyrimidin-4(1H)-one 95%, 6-PHENYLPYRIMIDIN-4(3H)-ONE, 95%+, 6-Phenylpyrimidin-4(1H)-one, 95%, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
4-phenyl-1H-pyrimidin-6-one (CAS 4891-69-4) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 4-phenyl-1H-pyrimidin-6-one. InChIKey: OATNBMJACLEOTB-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 4-phenyl-1H-pyrimidin-6-one |
| InChIKey | OATNBMJACLEOTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)NC=N2 |
Computed by PubChem (NCBI)