CAS 490-97-1 appears in our catalog under these names: 2–Fluorobenzoic acid, sodium salt, Sodium 2-fluorobenzoate, 98%, 98%, Sodium 2-fluorobenzoate, 99%, Sodium 2-fluorobenzoate, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 500g, 5g, 10g, 25g, 1g.
Sodium 2-fluorobenzoate (CAS 490-97-1) is a chemical compound with the molecular formula C7H4FNaO2 and a molecular weight of 162.09 g/mol. IUPAC name: sodium 2-fluorobenzoate. InChIKey: AKLMJAAHRPOLKF-UHFFFAOYSA-M.
| Molecular formula | C7H4FNaO2 |
|---|---|
| Molecular weight | 162.09 g/mol |
| IUPAC name | sodium 2-fluorobenzoate |
| InChIKey | AKLMJAAHRPOLKF-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])F.[Na+] |
Computed by PubChem (NCBI)