CAS 499-57-0 appears in our catalog under these names: Sodium 3-fluorobenzoate, 95%, Sodium 3–fluorobenzoate, Sodium 3-fluorobenzoate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 500g, 10g.
Sodium 3-fluorobenzoate (CAS 499-57-0) is a chemical compound with the molecular formula C7H4FNaO2 and a molecular weight of 162.09 g/mol. IUPAC name: sodium 3-fluorobenzoate. InChIKey: GCXUCULHJVOCJG-UHFFFAOYSA-M.
| Molecular formula | C7H4FNaO2 |
|---|---|
| Molecular weight | 162.09 g/mol |
| IUPAC name | sodium 3-fluorobenzoate |
| InChIKey | GCXUCULHJVOCJG-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)F)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)