Products 491828-75-2
CAS 491828-75-2 is the registry number for PMED-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2-phenylcyclopropane-1-carboxamide (CAS 491828-75-2) is a chemical compound with the molecular formula C20H18FN3O and a molecular weight of 335.4 g/mol. IUPAC name: N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2-phenylcyclopropane-1-carboxamide. InChIKey: NSIMIZBPCMJSGO-UHFFFAOYSA-N.
| Molecular formula | C20H18FN3O |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-2-phenylcyclopropane-1-carboxamide |
| InChIKey | NSIMIZBPCMJSGO-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)NC2=CN(N=C2)CC3=CC=C(C=C3)F)C4=CC=CC=C4 |
Computed by PubChem (NCBI)